C17H20N2O4S2 — CID 22506620
3-[(N-thiophen-2-ylsulfonylanilino)methyl]piperidine-1-carboxylic acid (PubChem CID 22506620) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 3-[(N-thiophen-2-ylsulfonylanilino)methyl]piperidine-1-carboxylic acid.
| Compound Name | 3-[(N-thiophen-2-ylsulfonylanilino)methyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 22506620 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 3-[(N-thiophen-2-ylsulfonylanilino)methyl]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCCC(CN(c2ccccc2)S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C17H20N2O4S2/c20-17(21)18-10-4-6-14(12-18)13-19(15-7-2-1-3-8-15)25(22,23)16-9-5-11-24-16/h1-3,5,7-9,11,14H,4,6,10,12-13H2,(H,20,21) |
| InChIKey | JGULPMYIMRRKBA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |