C14H21N3O5S2 — CID 122007238
1-[2-[methyl(thiophen-2-ylsulfonyl)amino]ethylcarbamoyl]piperidine-3-carboxylic acid (PubChem CID 122007238) has the molecular formula C14H21N3O5S2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-[2-[methyl(thiophen-2-ylsulfonyl)amino]ethylcarbamoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-[methyl(thiophen-2-ylsulfonyl)amino]ethylcarbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122007238 |
| Molecular Formula | C14H21N3O5S2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 1-[2-[methyl(thiophen-2-ylsulfonyl)amino]ethylcarbamoyl]piperidine-3-carboxylic acid |
| SMILES | CN(CCNC(=O)N1CCCC(C(=O)O)C1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H21N3O5S2/c1-16(24(21,22)12-5-3-9-23-12)8-6-15-14(20)17-7-2-4-11(10-17)13(18)19/h3,5,9,11H,2,4,6-8,10H2,1H3,(H,15,20)(H,18,19) |
| InChIKey | KPBICHMYWDDMFC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |