C15H18N2O3S2 — CID 166265986
N-(cyclobutylmethyl)-3-methoxy-N-phenyl-1,2-thiazole-5-sulfonamide (PubChem CID 166265986) has the molecular formula C15H18N2O3S2 and a molecular weight of 338.45 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-3-methoxy-N-phenyl-1,2-thiazole-5-sulfonamide.
| Compound Name | N-(cyclobutylmethyl)-3-methoxy-N-phenyl-1,2-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 166265986 |
| Molecular Formula | C15H18N2O3S2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | N-(cyclobutylmethyl)-3-methoxy-N-phenyl-1,2-thiazole-5-sulfonamide |
| SMILES | COc1cc(S(=O)(=O)N(CC2CCC2)c2ccccc2)sn1 |
| InChI | InChI=1S/C15H18N2O3S2/c1-20-14-10-15(21-16-14)22(18,19)17(11-12-6-5-7-12)13-8-3-2-4-9-13/h2-4,8-10,12H,5-7,11H2,1H3 |
| InChIKey | OCYOTZLJOITJKO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |