C13H19ClN2O — CID 119337195
2-amino-N-(cyclobutylmethyl)-N-phenylacetamide;hydrochloride (PubChem CID 119337195) has the molecular formula C13H19ClN2O and a molecular weight of 254.76 g/mol. Its IUPAC name is 2-amino-N-(cyclobutylmethyl)-N-phenylacetamide;hydrochloride.
| Compound Name | 2-amino-N-(cyclobutylmethyl)-N-phenylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119337195 |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-amino-N-(cyclobutylmethyl)-N-phenylacetamide;hydrochloride |
| SMILES | Cl.NCC(=O)N(CC1CCC1)c1ccccc1 |
| InChI | InChI=1S/C13H18N2O.ClH/c14-9-13(16)15(10-11-5-4-6-11)12-7-2-1-3-8-12;/h1-3,7-8,11H,4-6,9-10,14H2;1H |
| InChIKey | IENHSPIQOSVMQK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |