C21H21N3O3 — CID 139011726
N-(cyclobutylmethyl)-2-(2,4-dioxo-1H-quinazolin-3-yl)-N-phenylacetamide (PubChem CID 139011726) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-2-(2,4-dioxo-1H-quinazolin-3-yl)-N-phenylacetamide.
| Compound Name | N-(cyclobutylmethyl)-2-(2,4-dioxo-1H-quinazolin-3-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 139011726 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-(cyclobutylmethyl)-2-(2,4-dioxo-1H-quinazolin-3-yl)-N-phenylacetamide |
| SMILES | O=C(Cn1c(=O)[nH]c2ccccc2c1=O)N(CC1CCC1)c1ccccc1 |
| InChI | InChI=1S/C21H21N3O3/c25-19(23(13-15-7-6-8-15)16-9-2-1-3-10-16)14-24-20(26)17-11-4-5-12-18(17)22-21(24)27/h1-5,9-12,15H,6-8,13-14H2,(H,22,27) |
| InChIKey | CSJLDTDNPZRNHX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |