C15H18N2O3 — CID 111466203
3-[(3-hydroxycyclohexyl)methyl]-1H-quinazoline-2,4-dione (PubChem CID 111466203) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-[(3-hydroxycyclohexyl)methyl]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[(3-hydroxycyclohexyl)methyl]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 111466203 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 3-[(3-hydroxycyclohexyl)methyl]-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2ccccc2c(=O)n1CC1CCCC(O)C1 |
| InChI | InChI=1S/C15H18N2O3/c18-11-5-3-4-10(8-11)9-17-14(19)12-6-1-2-7-13(12)16-15(17)20/h1-2,6-7,10-11,18H,3-5,8-9H2,(H,16,20) |
| InChIKey | SBABMHAJKYTYGM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |