C14H17NO2S — CID 114147581
2-[(3-hydroxycyclohexyl)methyl]-1,2-benzothiazol-3-one (PubChem CID 114147581) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is 2-[(3-hydroxycyclohexyl)methyl]-1,2-benzothiazol-3-one.
| Compound Name | 2-[(3-hydroxycyclohexyl)methyl]-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 114147581 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 2-[(3-hydroxycyclohexyl)methyl]-1,2-benzothiazol-3-one |
| SMILES | O=c1c2ccccc2sn1CC1CCCC(O)C1 |
| InChI | InChI=1S/C14H17NO2S/c16-11-5-3-4-10(8-11)9-15-14(17)12-6-1-2-7-13(12)18-15/h1-2,6-7,10-11,16H,3-5,8-9H2 |
| InChIKey | DPWRKXIEBOQOCC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |