C21H25NO4S — CID 139532553
N-(4-cyclobutyl-4-oxobutyl)-4-methoxy-N-phenylbenzenesulfonamide (PubChem CID 139532553) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is N-(4-cyclobutyl-4-oxobutyl)-4-methoxy-N-phenylbenzenesulfonamide.
| Compound Name | N-(4-cyclobutyl-4-oxobutyl)-4-methoxy-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 139532553 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | N-(4-cyclobutyl-4-oxobutyl)-4-methoxy-N-phenylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCCC(=O)C2CCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H25NO4S/c1-26-19-12-14-20(15-13-19)27(24,25)22(18-9-3-2-4-10-18)16-6-11-21(23)17-7-5-8-17/h2-4,9-10,12-15,17H,5-8,11,16H2,1H3 |
| InChIKey | MPLYDNKSSFKNQI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |