C20H23NO4S — CID 8502968
[4-[ethyl(phenyl)sulfamoyl]phenyl] cyclopentanecarboxylate (PubChem CID 8502968) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is [4-[ethyl(phenyl)sulfamoyl]phenyl] cyclopentanecarboxylate.
| Compound Name | [4-[ethyl(phenyl)sulfamoyl]phenyl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 8502968 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | [4-[ethyl(phenyl)sulfamoyl]phenyl] cyclopentanecarboxylate |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(OC(=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C20H23NO4S/c1-2-21(17-10-4-3-5-11-17)26(23,24)19-14-12-18(13-15-19)25-20(22)16-8-6-7-9-16/h3-5,10-16H,2,6-9H2,1H3 |
| InChIKey | KQEIOTUMIOCOCB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|