C54H66N2O8S2 — CID 161310373
N-[4-(2-adamantyl)-4-oxobutyl]-4-methoxy-N-phenylbenzenesulfonamide (PubChem CID 161310373) has the molecular formula C54H66N2O8S2 and a molecular weight of 935.26 g/mol. Its IUPAC name is N-[4-(2-adamantyl)-4-oxobutyl]-4-methoxy-N-phenylbenzenesulfonamide.
| Compound Name | N-[4-(2-adamantyl)-4-oxobutyl]-4-methoxy-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 161310373 |
| Molecular Formula | C54H66N2O8S2 |
| Molecular Weight | 935.26 g/mol |
| Exact Mass | 934.43 |
| IUPAC Name | N-[4-(2-adamantyl)-4-oxobutyl]-4-methoxy-N-phenylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCCC(=O)C2C3CC4CC(C3)CC2C4)c2ccccc2)cc1.COc1ccc(S(=O)(=O)N(CCCC(=O)C2C3CC4CC(C3)CC2C4)c2ccccc2)cc1 |
| InChI | InChI=1S/2C27H33NO4S/c2*1-32-24-9-11-25(12-10-24)33(30,31)28(23-6-3-2-4-7-23)13-5-8-26(29)27-21-15-19-14-20(17-21)18-22(27)16-19/h2*2-4,6-7,9-12,19-22,27H,5,8,13-18H2,1H3 |
| InChIKey | VIUNMEFPMQFUBX-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.26 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |