C21H23N3O2S — CID 22506630
N-phenyl-N-(piperidin-3-ylmethyl)quinoline-8-sulfonamide (PubChem CID 22506630) has the molecular formula C21H23N3O2S and a molecular weight of 381.50 g/mol. Its IUPAC name is N-phenyl-N-(piperidin-3-ylmethyl)quinoline-8-sulfonamide.
| Compound Name | N-phenyl-N-(piperidin-3-ylmethyl)quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 22506630 |
| Molecular Formula | C21H23N3O2S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | N-phenyl-N-(piperidin-3-ylmethyl)quinoline-8-sulfonamide |
| SMILES | O=S(=O)(c1cccc2cccnc12)N(CC1CCCNC1)c1ccccc1 |
| InChI | InChI=1S/C21H23N3O2S/c25-27(26,20-12-4-8-18-9-6-14-23-21(18)20)24(19-10-2-1-3-11-19)16-17-7-5-13-22-15-17/h1-4,6,8-12,14,17,22H,5,7,13,15-16H2 |
| InChIKey | JEFJCIBDUPDUDA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |