C20H29ClN4O2S — CID 146065089
N-(2-piperidin-1-ylethyl)-N-pyrrolidin-3-ylquinoline-8-sulfonamide;hydrochloride (PubChem CID 146065089) has the molecular formula C20H29ClN4O2S and a molecular weight of 425.00 g/mol. Its IUPAC name is N-(2-piperidin-1-ylethyl)-N-pyrrolidin-3-ylquinoline-8-sulfonamide;hydrochloride.
| Compound Name | N-(2-piperidin-1-ylethyl)-N-pyrrolidin-3-ylquinoline-8-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 146065089 |
| Molecular Formula | C20H29ClN4O2S |
| Molecular Weight | 425.00 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N-(2-piperidin-1-ylethyl)-N-pyrrolidin-3-ylquinoline-8-sulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(c1cccc2cccnc12)N(CCN1CCCCC1)C1CCNC1 |
| InChI | InChI=1S/C20H28N4O2S.ClH/c25-27(26,19-8-4-6-17-7-5-10-22-20(17)19)24(18-9-11-21-16-18)15-14-23-12-2-1-3-13-23;/h4-8,10,18,21H,1-3,9,11-16H2;1H |
| InChIKey | PLNCSQFGSBJZSA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.00 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |