C18H30ClN3O3S — CID 146065088
4-ethoxy-N-pyrrolidin-3-yl-N-(2-pyrrolidin-1-ylethyl)benzenesulfonamide;hydrochloride (PubChem CID 146065088) has the molecular formula C18H30ClN3O3S and a molecular weight of 403.98 g/mol. Its IUPAC name is 4-ethoxy-N-pyrrolidin-3-yl-N-(2-pyrrolidin-1-ylethyl)benzenesulfonamide;hydrochloride.
| Compound Name | 4-ethoxy-N-pyrrolidin-3-yl-N-(2-pyrrolidin-1-ylethyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 146065088 |
| Molecular Formula | C18H30ClN3O3S |
| Molecular Weight | 403.98 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 4-ethoxy-N-pyrrolidin-3-yl-N-(2-pyrrolidin-1-ylethyl)benzenesulfonamide;hydrochloride |
| SMILES | CCOc1ccc(S(=O)(=O)N(CCN2CCCC2)C2CCNC2)cc1.Cl |
| InChI | InChI=1S/C18H29N3O3S.ClH/c1-2-24-17-5-7-18(8-6-17)25(22,23)21(16-9-10-19-15-16)14-13-20-11-3-4-12-20;/h5-8,16,19H,2-4,9-15H2,1H3;1H |
| InChIKey | WPYZIPWEWVNHLU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.98 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |