C15H26ClN3O2S2 — CID 146065101
N-(2-piperidin-1-ylethyl)-N-pyrrolidin-3-ylthiophene-2-sulfonamide;hydrochloride (PubChem CID 146065101) has the molecular formula C15H26ClN3O2S2 and a molecular weight of 379.98 g/mol. Its IUPAC name is N-(2-piperidin-1-ylethyl)-N-pyrrolidin-3-ylthiophene-2-sulfonamide;hydrochloride.
| Compound Name | N-(2-piperidin-1-ylethyl)-N-pyrrolidin-3-ylthiophene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 146065101 |
| Molecular Formula | C15H26ClN3O2S2 |
| Molecular Weight | 379.98 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | N-(2-piperidin-1-ylethyl)-N-pyrrolidin-3-ylthiophene-2-sulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(c1cccs1)N(CCN1CCCCC1)C1CCNC1 |
| InChI | InChI=1S/C15H25N3O2S2.ClH/c19-22(20,15-5-4-12-21-15)18(14-6-7-16-13-14)11-10-17-8-2-1-3-9-17;/h4-5,12,14,16H,1-3,6-11,13H2;1H |
| InChIKey | TUPYXBFMGONNGK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.98 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |