C17H28N4O3S2 — CID 20934420
N-(2-oxo-2-piperazin-1-ylethyl)-N-(2-piperidin-1-ylethyl)thiophene-2-sulfonamide (PubChem CID 20934420) has the molecular formula C17H28N4O3S2 and a molecular weight of 400.57 g/mol. Its IUPAC name is N-(2-oxo-2-piperazin-1-ylethyl)-N-(2-piperidin-1-ylethyl)thiophene-2-sulfonamide.
| Compound Name | N-(2-oxo-2-piperazin-1-ylethyl)-N-(2-piperidin-1-ylethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 20934420 |
| Molecular Formula | C17H28N4O3S2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-(2-oxo-2-piperazin-1-ylethyl)-N-(2-piperidin-1-ylethyl)thiophene-2-sulfonamide |
| SMILES | O=C(CN(CCN1CCCCC1)S(=O)(=O)c1cccs1)N1CCNCC1 |
| InChI | InChI=1S/C17H28N4O3S2/c22-16(20-10-6-18-7-11-20)15-21(13-12-19-8-2-1-3-9-19)26(23,24)17-5-4-14-25-17/h4-5,14,18H,1-3,6-13,15H2 |
| InChIKey | KQWSPVLBPHZUPP-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |