C21H34N4O3S — CID 50788442
4-ethyl-N-(2-oxo-2-piperazin-1-ylethyl)-N-(2-piperidin-1-ylethyl)benzenesulfonamide (PubChem CID 50788442) has the molecular formula C21H34N4O3S and a molecular weight of 422.60 g/mol. Its IUPAC name is 4-ethyl-N-(2-oxo-2-piperazin-1-ylethyl)-N-(2-piperidin-1-ylethyl)benzenesulfonamide.
| Compound Name | 4-ethyl-N-(2-oxo-2-piperazin-1-ylethyl)-N-(2-piperidin-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 50788442 |
| Molecular Formula | C21H34N4O3S |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 4-ethyl-N-(2-oxo-2-piperazin-1-ylethyl)-N-(2-piperidin-1-ylethyl)benzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)N(CCN2CCCCC2)CC(=O)N2CCNCC2)cc1 |
| InChI | InChI=1S/C21H34N4O3S/c1-2-19-6-8-20(9-7-19)29(27,28)25(17-16-23-12-4-3-5-13-23)18-21(26)24-14-10-22-11-15-24/h6-9,22H,2-5,10-18H2,1H3 |
| InChIKey | XBACBGSMAMNZLF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |