C23H38N4O4S — CID 50775980
4-ethoxy-N-(3-oxo-3-piperazin-1-ylpropyl)-N-(3-piperidin-1-ylpropyl)benzenesulfonamide (PubChem CID 50775980) has the molecular formula C23H38N4O4S and a molecular weight of 466.65 g/mol. Its IUPAC name is 4-ethoxy-N-(3-oxo-3-piperazin-1-ylpropyl)-N-(3-piperidin-1-ylpropyl)benzenesulfonamide.
| Compound Name | 4-ethoxy-N-(3-oxo-3-piperazin-1-ylpropyl)-N-(3-piperidin-1-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 50775980 |
| Molecular Formula | C23H38N4O4S |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 4-ethoxy-N-(3-oxo-3-piperazin-1-ylpropyl)-N-(3-piperidin-1-ylpropyl)benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(CCCN2CCCCC2)CCC(=O)N2CCNCC2)cc1 |
| InChI | InChI=1S/C23H38N4O4S/c1-2-31-21-7-9-22(10-8-21)32(29,30)27(17-6-16-25-14-4-3-5-15-25)18-11-23(28)26-19-12-24-13-20-26/h7-10,24H,2-6,11-20H2,1H3 |
| InChIKey | WSCCYWZVSUZROL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |