C22H36N4O3S — CID 50775815
4-methyl-N-(3-oxo-3-piperazin-1-ylpropyl)-N-(3-piperidin-1-ylpropyl)benzenesulfonamide (PubChem CID 50775815) has the molecular formula C22H36N4O3S and a molecular weight of 436.62 g/mol. Its IUPAC name is 4-methyl-N-(3-oxo-3-piperazin-1-ylpropyl)-N-(3-piperidin-1-ylpropyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(3-oxo-3-piperazin-1-ylpropyl)-N-(3-piperidin-1-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 50775815 |
| Molecular Formula | C22H36N4O3S |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 4-methyl-N-(3-oxo-3-piperazin-1-ylpropyl)-N-(3-piperidin-1-ylpropyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CCCN2CCCCC2)CCC(=O)N2CCNCC2)cc1 |
| InChI | InChI=1S/C22H36N4O3S/c1-20-6-8-21(9-7-20)30(28,29)26(16-5-15-24-13-3-2-4-14-24)17-10-22(27)25-18-11-23-12-19-25/h6-9,23H,2-5,10-19H2,1H3 |
| InChIKey | GVENUZIBHYCJEO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |