C20H32N4O4S — CID 50788677
4-ethoxy-N-(2-oxo-2-piperazin-1-ylethyl)-N-(2-pyrrolidin-1-ylethyl)benzenesulfonamide (PubChem CID 50788677) has the molecular formula C20H32N4O4S and a molecular weight of 424.57 g/mol. Its IUPAC name is 4-ethoxy-N-(2-oxo-2-piperazin-1-ylethyl)-N-(2-pyrrolidin-1-ylethyl)benzenesulfonamide.
| Compound Name | 4-ethoxy-N-(2-oxo-2-piperazin-1-ylethyl)-N-(2-pyrrolidin-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 50788677 |
| Molecular Formula | C20H32N4O4S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 4-ethoxy-N-(2-oxo-2-piperazin-1-ylethyl)-N-(2-pyrrolidin-1-ylethyl)benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(CCN2CCCC2)CC(=O)N2CCNCC2)cc1 |
| InChI | InChI=1S/C20H32N4O4S/c1-2-28-18-5-7-19(8-6-18)29(26,27)24(16-15-22-11-3-4-12-22)17-20(25)23-13-9-21-10-14-23/h5-8,21H,2-4,9-17H2,1H3 |
| InChIKey | URSWNHPDHZSEIA-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |