C19H29N3O5S — CID 94078433
4-ethoxy-N-[[(2S)-oxolan-2-yl]methyl]-N-(2-oxo-2-piperazin-1-ylethyl)benzenesulfonamide (PubChem CID 94078433) has the molecular formula C19H29N3O5S and a molecular weight of 411.52 g/mol. Its IUPAC name is 4-ethoxy-N-[[(2S)-oxolan-2-yl]methyl]-N-(2-oxo-2-piperazin-1-ylethyl)benzenesulfonamide.
| Compound Name | 4-ethoxy-N-[[(2S)-oxolan-2-yl]methyl]-N-(2-oxo-2-piperazin-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 94078433 |
| Molecular Formula | C19H29N3O5S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 4-ethoxy-N-[[(2S)-oxolan-2-yl]methyl]-N-(2-oxo-2-piperazin-1-ylethyl)benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(CC(=O)N2CCNCC2)C[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C19H29N3O5S/c1-2-26-16-5-7-18(8-6-16)28(24,25)22(14-17-4-3-13-27-17)15-19(23)21-11-9-20-10-12-21/h5-8,17,20H,2-4,9-15H2,1H3/t17-/m0/s1 |
| InChIKey | SYFCQFRXXAYDCF-KRWDZBQOSA-N |
| XLogP | 0.69 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |