C16H25NO2S2 — CID 19682432
N,N-dicyclohexylthiophene-2-sulfonamide (PubChem CID 19682432) has the molecular formula C16H25NO2S2 and a molecular weight of 327.51 g/mol. Its IUPAC name is N,N-dicyclohexylthiophene-2-sulfonamide.
| Compound Name | N,N-dicyclohexylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 19682432 |
| Molecular Formula | C16H25NO2S2 |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N,N-dicyclohexylthiophene-2-sulfonamide |
| SMILES | O=S(=O)(c1cccs1)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C16H25NO2S2/c18-21(19,16-12-7-13-20-16)17(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h7,12-15H,1-6,8-11H2 |
| InChIKey | IEYZQOPCQAADQP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |