C11H15NO4S3 — CID 47317810
N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)thiophene-2-sulfonamide (PubChem CID 47317810) has the molecular formula C11H15NO4S3 and a molecular weight of 321.45 g/mol. Its IUPAC name is N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)thiophene-2-sulfonamide.
| Compound Name | N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 47317810 |
| Molecular Formula | C11H15NO4S3 |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)thiophene-2-sulfonamide |
| SMILES | O=S1(=O)CCC(N(C2CC2)S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C11H15NO4S3/c13-18(14)7-5-10(8-18)12(9-3-4-9)19(15,16)11-2-1-6-17-11/h1-2,6,9-10H,3-5,7-8H2 |
| InChIKey | MOXBPTQNCIJZQT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |