C13H17NO4S2 — CID 47130910
N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide (PubChem CID 47130910) has the molecular formula C13H17NO4S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide.
| Compound Name | N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 47130910 |
| Molecular Formula | C13H17NO4S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | N-cyclopropyl-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide |
| SMILES | O=S1(=O)CCC(N(C2CC2)S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C13H17NO4S2/c15-19(16)9-8-12(10-19)14(11-6-7-11)20(17,18)13-4-2-1-3-5-13/h1-5,11-12H,6-10H2 |
| InChIKey | YFPUADWNSBVJLW-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |