C16H16ClNO4S2 — CID 21206461
N-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide (PubChem CID 21206461) has the molecular formula C16H16ClNO4S2 and a molecular weight of 385.89 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 21206461 |
| Molecular Formula | C16H16ClNO4S2 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | N-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide |
| SMILES | O=S1(=O)CCC(N(c2ccc(Cl)cc2)S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C16H16ClNO4S2/c17-13-6-8-14(9-7-13)18(15-10-11-23(19,20)12-15)24(21,22)16-4-2-1-3-5-16/h1-9,15H,10-12H2 |
| InChIKey | WNQDVDLXNZPSIH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |