C17H19NO5S2 — CID 21206459
N-(1,1-dioxothiolan-3-yl)-N-(4-methoxyphenyl)benzenesulfonamide (PubChem CID 21206459) has the molecular formula C17H19NO5S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-(4-methoxyphenyl)benzenesulfonamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-(4-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 21206459 |
| Molecular Formula | C17H19NO5S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-(4-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccc(N(C2CCS(=O)(=O)C2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H19NO5S2/c1-23-16-9-7-14(8-10-16)18(15-11-12-24(19,20)13-15)25(21,22)17-5-3-2-4-6-17/h2-10,15H,11-13H2,1H3 |
| InChIKey | UGCAUOFVMMAXRQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |