C30H35ClN2O3S — CID 91541603
4-chloro-N-(4-methoxyphenyl)-N-[1-(2-phenylcyclohexyl)piperidin-4-yl]benzenesulfonamide (PubChem CID 91541603) has the molecular formula C30H35ClN2O3S and a molecular weight of 539.14 g/mol. Its IUPAC name is 4-chloro-N-(4-methoxyphenyl)-N-[1-(2-phenylcyclohexyl)piperidin-4-yl]benzenesulfonamide.
| Compound Name | 4-chloro-N-(4-methoxyphenyl)-N-[1-(2-phenylcyclohexyl)piperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 91541603 |
| Molecular Formula | C30H35ClN2O3S |
| Molecular Weight | 539.14 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 4-chloro-N-(4-methoxyphenyl)-N-[1-(2-phenylcyclohexyl)piperidin-4-yl]benzenesulfonamide |
| SMILES | COc1ccc(N(C2CCN(C3CCCCC3c3ccccc3)CC2)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C30H35ClN2O3S/c1-36-27-15-13-25(14-16-27)33(37(34,35)28-17-11-24(31)12-18-28)26-19-21-32(22-20-26)30-10-6-5-9-29(30)23-7-3-2-4-8-23/h2-4,7-8,11-18,26,29-30H,5-6,9-10,19-22H2,1H3 |
| InChIKey | HRYODRLMRXUVOO-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.14 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |