C32H38N2O3 — CID 91137183
3-methoxy-N-(4-methoxyphenyl)-N-[1-(2-phenylcyclohexyl)piperidin-4-yl]benzamide (PubChem CID 91137183) has the molecular formula C32H38N2O3 and a molecular weight of 498.67 g/mol. Its IUPAC name is 3-methoxy-N-(4-methoxyphenyl)-N-[1-(2-phenylcyclohexyl)piperidin-4-yl]benzamide.
| Compound Name | 3-methoxy-N-(4-methoxyphenyl)-N-[1-(2-phenylcyclohexyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 91137183 |
| Molecular Formula | C32H38N2O3 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | 3-methoxy-N-(4-methoxyphenyl)-N-[1-(2-phenylcyclohexyl)piperidin-4-yl]benzamide |
| SMILES | COc1ccc(N(C(=O)c2cccc(OC)c2)C2CCN(C3CCCCC3c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C32H38N2O3/c1-36-28-17-15-26(16-18-28)34(32(35)25-11-8-12-29(23-25)37-2)27-19-21-33(22-20-27)31-14-7-6-13-30(31)24-9-4-3-5-10-24/h3-5,8-12,15-18,23,27,30-31H,6-7,13-14,19-22H2,1-2H3 |
| InChIKey | SMDVCVOXQYWJCZ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |