C31H34Cl2N2O2 — CID 91128636
3,4-dichloro-N-(4-methoxyphenyl)-N-[1-(2-phenylcyclohexyl)piperidin-4-yl]benzamide (PubChem CID 91128636) has the molecular formula C31H34Cl2N2O2 and a molecular weight of 537.53 g/mol. Its IUPAC name is 3,4-dichloro-N-(4-methoxyphenyl)-N-[1-(2-phenylcyclohexyl)piperidin-4-yl]benzamide.
| Compound Name | 3,4-dichloro-N-(4-methoxyphenyl)-N-[1-(2-phenylcyclohexyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 91128636 |
| Molecular Formula | C31H34Cl2N2O2 |
| Molecular Weight | 537.53 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 3,4-dichloro-N-(4-methoxyphenyl)-N-[1-(2-phenylcyclohexyl)piperidin-4-yl]benzamide |
| SMILES | COc1ccc(N(C(=O)c2ccc(Cl)c(Cl)c2)C2CCN(C3CCCCC3c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C31H34Cl2N2O2/c1-37-26-14-12-24(13-15-26)35(31(36)23-11-16-28(32)29(33)21-23)25-17-19-34(20-18-25)30-10-6-5-9-27(30)22-7-3-2-4-8-22/h2-4,7-8,11-16,21,25,27,30H,5-6,9-10,17-20H2,1H3 |
| InChIKey | FPRQYSQWBYOHFZ-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.53 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |