C32H38N2O — CID 91468186
N-(3,5-dimethylphenyl)-N-[1-(2-phenylcyclohexyl)piperidin-4-yl]benzamide (PubChem CID 91468186) has the molecular formula C32H38N2O and a molecular weight of 466.67 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-N-[1-(2-phenylcyclohexyl)piperidin-4-yl]benzamide.
| Compound Name | N-(3,5-dimethylphenyl)-N-[1-(2-phenylcyclohexyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 91468186 |
| Molecular Formula | C32H38N2O |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.30 |
| IUPAC Name | N-(3,5-dimethylphenyl)-N-[1-(2-phenylcyclohexyl)piperidin-4-yl]benzamide |
| SMILES | Cc1cc(C)cc(N(C(=O)c2ccccc2)C2CCN(C3CCCCC3c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C32H38N2O/c1-24-21-25(2)23-29(22-24)34(32(35)27-13-7-4-8-14-27)28-17-19-33(20-18-28)31-16-10-9-15-30(31)26-11-5-3-6-12-26/h3-8,11-14,21-23,28,30-31H,9-10,15-20H2,1-2H3 |
| InChIKey | XHCJDQZLBFVFEK-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |