C30H32Cl2N2O — CID 91312760
3,4-dichloro-N-phenyl-N-[1-(2-phenylcyclohexyl)piperidin-4-yl]benzamide (PubChem CID 91312760) has the molecular formula C30H32Cl2N2O and a molecular weight of 507.51 g/mol. Its IUPAC name is 3,4-dichloro-N-phenyl-N-[1-(2-phenylcyclohexyl)piperidin-4-yl]benzamide.
| Compound Name | 3,4-dichloro-N-phenyl-N-[1-(2-phenylcyclohexyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 91312760 |
| Molecular Formula | C30H32Cl2N2O |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 3,4-dichloro-N-phenyl-N-[1-(2-phenylcyclohexyl)piperidin-4-yl]benzamide |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)N(c1ccccc1)C1CCN(C2CCCCC2c2ccccc2)CC1 |
| InChI | InChI=1S/C30H32Cl2N2O/c31-27-16-15-23(21-28(27)32)30(35)34(24-11-5-2-6-12-24)25-17-19-33(20-18-25)29-14-8-7-13-26(29)22-9-3-1-4-10-22/h1-6,9-12,15-16,21,25-26,29H,7-8,13-14,17-20H2 |
| InChIKey | USXVPZGFFVOTTC-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |