About N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzamide
N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzamide (PubChem CID 91480833) has the molecular formula C30H34N2O
and a molecular weight of 438.62 g/mol. Its IUPAC name is N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzamide.
Molecular Properties
| Compound Name | N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzamide |
| PubChem CID | 91480833 |
| Molecular Formula | C30H34N2O |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzamide |
| SMILES | O=C(c1ccccc1)N(c1ccccc1)C1CCN([C@@H]2CCCC[C@@H]2c2ccccc2)CC1 |
| InChI | InChI=1S/C30H34N2O/c33-30(25-14-6-2-7-15-25)32(26-16-8-3-9-17-26)27-20-22-31(23-21-27)29-19-11-10-18-28(29)24-12-4-1-5-13-24/h1-9,12-17,27-29H,10-11,18-23H2/t28-,29-/m1/s1 |
| InChIKey | TUINVHRJLLSTGZ-FQLXRVMXSA-N |
| XLogP | 6.52 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzamide?
The IUPAC name of N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzamide (CID 91480833) is N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzamide.
What is the SMILES notation for N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzamide?
The canonical SMILES for N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzamide is O=C(c1ccccc1)N(c1ccccc1)C1CCN([C@@H]2CCCC[C@@H]2c2ccccc2)CC1.
What is the InChIKey of N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzamide?
The InChIKey is TUINVHRJLLSTGZ-FQLXRVMXSA-N. The full InChI is InChI=1S/C30H34N2O/c33-30(25-14-6-2-7-15-25)32(26-16-8-3-9-17-26)27-20-22-31(23-21-27)29-19-11-10-18-28(29)24-12-4-1-5-13-24/h1-9,12-17,27-29H,10-11,18-23H2/t28-,29-/m1/s1.
What are the key properties of N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzamide?
N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzamide has a molecular weight of 438.62 g/mol, XLogP of 6.52, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzamide is sourced from PubChem (CID 91480833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).