C30H34N2O — CID 91480833
N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzamide (PubChem CID 91480833) has the molecular formula C30H34N2O and a molecular weight of 438.62 g/mol. Its IUPAC name is N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzamide.
| Compound Name | N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 91480833 |
| Molecular Formula | C30H34N2O |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | N-phenyl-N-[1-[(1R,2R)-2-phenylcyclohexyl]piperidin-4-yl]benzamide |
| SMILES | O=C(c1ccccc1)N(c1ccccc1)C1CCN([C@@H]2CCCC[C@@H]2c2ccccc2)CC1 |
| InChI | InChI=1S/C30H34N2O/c33-30(25-14-6-2-7-15-25)32(26-16-8-3-9-17-26)27-20-22-31(23-21-27)29-19-11-10-18-28(29)24-12-4-1-5-13-24/h1-9,12-17,27-29H,10-11,18-23H2/t28-,29-/m1/s1 |
| InChIKey | TUINVHRJLLSTGZ-FQLXRVMXSA-N |
| XLogP | 6.52 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |