C30H36N2O2S — CID 91422522
N-(2-methylphenyl)-N-[1-(2-phenylcyclohexyl)piperidin-4-yl]benzenesulfonamide (PubChem CID 91422522) has the molecular formula C30H36N2O2S and a molecular weight of 488.70 g/mol. Its IUPAC name is N-(2-methylphenyl)-N-[1-(2-phenylcyclohexyl)piperidin-4-yl]benzenesulfonamide.
| Compound Name | N-(2-methylphenyl)-N-[1-(2-phenylcyclohexyl)piperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 91422522 |
| Molecular Formula | C30H36N2O2S |
| Molecular Weight | 488.70 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | N-(2-methylphenyl)-N-[1-(2-phenylcyclohexyl)piperidin-4-yl]benzenesulfonamide |
| SMILES | Cc1ccccc1N(C1CCN(C2CCCCC2c2ccccc2)CC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H36N2O2S/c1-24-12-8-10-18-29(24)32(35(33,34)27-15-6-3-7-16-27)26-20-22-31(23-21-26)30-19-11-9-17-28(30)25-13-4-2-5-14-25/h2-8,10,12-16,18,26,28,30H,9,11,17,19-23H2,1H3 |
| InChIKey | BDMMQBIRQCBDNY-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.70 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |