C21H33N3O — CID 69486342
1-(2-phenylcyclohexyl)-4-(propan-2-ylamino)piperidine-4-carboxamide (PubChem CID 69486342) has the molecular formula C21H33N3O and a molecular weight of 343.51 g/mol. Its IUPAC name is 1-(2-phenylcyclohexyl)-4-(propan-2-ylamino)piperidine-4-carboxamide.
| Compound Name | 1-(2-phenylcyclohexyl)-4-(propan-2-ylamino)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 69486342 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | 1-(2-phenylcyclohexyl)-4-(propan-2-ylamino)piperidine-4-carboxamide |
| SMILES | CC(C)NC1(C(N)=O)CCN(C2CCCCC2c2ccccc2)CC1 |
| InChI | InChI=1S/C21H33N3O/c1-16(2)23-21(20(22)25)12-14-24(15-13-21)19-11-7-6-10-18(19)17-8-4-3-5-9-17/h3-5,8-9,16,18-19,23H,6-7,10-15H2,1-2H3,(H2,22,25) |
| InChIKey | CDVYQDSOSAAXFZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |