2-(4-chloro-N-(1,1-dioxothiolan-3-yl)anilino)acetic acid

C12H14ClNO4S — CID 60834017

IUPAC2-(4-chloro-N-(1,1-dioxothiolan-3-yl)anilino)acetic acid
SMILESO=C(O)CN(c1ccc(Cl)cc1)C1CCS(=O)(=O)C1
InChIInChI=1S/C12H14ClNO4S/c13-9-1-3-10(4-2-9)14(7-12(15)16)11-5-6-19(17,18)8-11/h1-4,11H,5-8H2,(H,15,16)
InChIKeySGGFEDGLXCPLMS-UHFFFAOYSA-N
MW303.77 g/mol
LogP1.42
Rot. Bonds4

About 2-(4-chloro-N-(1,1-dioxothiolan-3-yl)anilino)acetic acid

2-(4-chloro-N-(1,1-dioxothiolan-3-yl)anilino)acetic acid (PubChem CID 60834017) has the molecular formula C12H14ClNO4S and a molecular weight of 303.77 g/mol. Its IUPAC name is 2-(4-chloro-N-(1,1-dioxothiolan-3-yl)anilino)acetic acid.

Molecular Properties

Compound Name2-(4-chloro-N-(1,1-dioxothiolan-3-yl)anilino)acetic acid
PubChem CID60834017
Molecular FormulaC12H14ClNO4S
Molecular Weight303.77 g/mol
Exact Mass303.03
IUPAC Name2-(4-chloro-N-(1,1-dioxothiolan-3-yl)anilino)acetic acid
SMILESO=C(O)CN(c1ccc(Cl)cc1)C1CCS(=O)(=O)C1
InChIInChI=1S/C12H14ClNO4S/c13-9-1-3-10(4-2-9)14(7-12(15)16)11-5-6-19(17,18)8-11/h1-4,11H,5-8H2,(H,15,16)
InChIKeySGGFEDGLXCPLMS-UHFFFAOYSA-N
XLogP1.42
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.77
LogP ≤ 51.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(4-chloro-N-(1,1-dioxothiolan-3-yl)anilino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-chloro-N-(1,1-dioxothiolan-3-yl)anilino)acetic acid?
The IUPAC name of 2-(4-chloro-N-(1,1-dioxothiolan-3-yl)anilino)acetic acid (CID 60834017) is 2-(4-chloro-N-(1,1-dioxothiolan-3-yl)anilino)acetic acid.
What is the SMILES notation for 2-(4-chloro-N-(1,1-dioxothiolan-3-yl)anilino)acetic acid?
The canonical SMILES for 2-(4-chloro-N-(1,1-dioxothiolan-3-yl)anilino)acetic acid is O=C(O)CN(c1ccc(Cl)cc1)C1CCS(=O)(=O)C1.
What is the InChIKey of 2-(4-chloro-N-(1,1-dioxothiolan-3-yl)anilino)acetic acid?
The InChIKey is SGGFEDGLXCPLMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClNO4S/c13-9-1-3-10(4-2-9)14(7-12(15)16)11-5-6-19(17,18)8-11/h1-4,11H,5-8H2,(H,15,16).
What are the key properties of 2-(4-chloro-N-(1,1-dioxothiolan-3-yl)anilino)acetic acid?
2-(4-chloro-N-(1,1-dioxothiolan-3-yl)anilino)acetic acid has a molecular weight of 303.77 g/mol, XLogP of 1.42, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-N-(1,1-dioxothiolan-3-yl)anilino)acetic acid is sourced from PubChem (CID 60834017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).