C13H16ClNO4S — CID 65057995
2-(3-chloro-N-(1,1-dioxothian-4-yl)anilino)acetic acid (PubChem CID 65057995) has the molecular formula C13H16ClNO4S and a molecular weight of 317.79 g/mol. Its IUPAC name is 2-(3-chloro-N-(1,1-dioxothian-4-yl)anilino)acetic acid.
| Compound Name | 2-(3-chloro-N-(1,1-dioxothian-4-yl)anilino)acetic acid |
|---|---|
| PubChem CID | 65057995 |
| Molecular Formula | C13H16ClNO4S |
| Molecular Weight | 317.79 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 2-(3-chloro-N-(1,1-dioxothian-4-yl)anilino)acetic acid |
| SMILES | O=C(O)CN(c1cccc(Cl)c1)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H16ClNO4S/c14-10-2-1-3-12(8-10)15(9-13(16)17)11-4-6-20(18,19)7-5-11/h1-3,8,11H,4-7,9H2,(H,16,17) |
| InChIKey | FZVYVYJKZLQFMQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.79 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |