C13H13ClN2O4S — CID 63082931
2-(5-chloro-2-cyano-N-(1,1-dioxothiolan-3-yl)anilino)acetic acid (PubChem CID 63082931) has the molecular formula C13H13ClN2O4S and a molecular weight of 328.78 g/mol. Its IUPAC name is 2-(5-chloro-2-cyano-N-(1,1-dioxothiolan-3-yl)anilino)acetic acid.
| Compound Name | 2-(5-chloro-2-cyano-N-(1,1-dioxothiolan-3-yl)anilino)acetic acid |
|---|---|
| PubChem CID | 63082931 |
| Molecular Formula | C13H13ClN2O4S |
| Molecular Weight | 328.78 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 2-(5-chloro-2-cyano-N-(1,1-dioxothiolan-3-yl)anilino)acetic acid |
| SMILES | N#Cc1ccc(Cl)cc1N(CC(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H13ClN2O4S/c14-10-2-1-9(6-15)12(5-10)16(7-13(17)18)11-3-4-21(19,20)8-11/h1-2,5,11H,3-4,7-8H2,(H,17,18) |
| InChIKey | YITDSMUGRAAITJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.78 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |