C14H18ClNO3S — CID 102565863
N-(5-chloro-2-methylphenyl)-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 102565863) has the molecular formula C14H18ClNO3S and a molecular weight of 315.82 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 102565863 |
| Molecular Formula | C14H18ClNO3S |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | CCC(=O)N(c1cc(Cl)ccc1C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H18ClNO3S/c1-3-14(17)16(12-6-7-20(18,19)9-12)13-8-11(15)5-4-10(13)2/h4-5,8,12H,3,6-7,9H2,1-2H3 |
| InChIKey | URYYQKMLQSIYOX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |