C13H15Cl2NO3S — CID 102566348
N-(2,4-dichlorophenyl)-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 102566348) has the molecular formula C13H15Cl2NO3S and a molecular weight of 336.24 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | N-(2,4-dichlorophenyl)-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 102566348 |
| Molecular Formula | C13H15Cl2NO3S |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | N-(2,4-dichlorophenyl)-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | CCC(=O)N(c1ccc(Cl)cc1Cl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H15Cl2NO3S/c1-2-13(17)16(10-5-6-20(18,19)8-10)12-4-3-9(14)7-11(12)15/h3-4,7,10H,2,5-6,8H2,1H3 |
| InChIKey | BRHMTTIYQCNLHC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |