C17H14Cl3NO3S — CID 102566612
4-chloro-N-(2,5-dichlorophenyl)-N-(1,1-dioxothiolan-3-yl)benzamide (PubChem CID 102566612) has the molecular formula C17H14Cl3NO3S and a molecular weight of 418.73 g/mol. Its IUPAC name is 4-chloro-N-(2,5-dichlorophenyl)-N-(1,1-dioxothiolan-3-yl)benzamide.
| Compound Name | 4-chloro-N-(2,5-dichlorophenyl)-N-(1,1-dioxothiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 102566612 |
| Molecular Formula | C17H14Cl3NO3S |
| Molecular Weight | 418.73 g/mol |
| Exact Mass | 416.98 |
| IUPAC Name | 4-chloro-N-(2,5-dichlorophenyl)-N-(1,1-dioxothiolan-3-yl)benzamide |
| SMILES | O=C(c1ccc(Cl)cc1)N(c1cc(Cl)ccc1Cl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H14Cl3NO3S/c18-12-3-1-11(2-4-12)17(22)21(14-7-8-25(23,24)10-14)16-9-13(19)5-6-15(16)20/h1-6,9,14H,7-8,10H2 |
| InChIKey | VLSPBTNOWYYVCA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.73 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |