C16H22ClNO4S — CID 102566110
4-chloro-N-(1,1-dioxothiolan-3-yl)-N-(5-hydroxypentyl)benzamide (PubChem CID 102566110) has the molecular formula C16H22ClNO4S and a molecular weight of 359.88 g/mol. Its IUPAC name is 4-chloro-N-(1,1-dioxothiolan-3-yl)-N-(5-hydroxypentyl)benzamide.
| Compound Name | 4-chloro-N-(1,1-dioxothiolan-3-yl)-N-(5-hydroxypentyl)benzamide |
|---|---|
| PubChem CID | 102566110 |
| Molecular Formula | C16H22ClNO4S |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 4-chloro-N-(1,1-dioxothiolan-3-yl)-N-(5-hydroxypentyl)benzamide |
| SMILES | O=C(c1ccc(Cl)cc1)N(CCCCCO)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H22ClNO4S/c17-14-6-4-13(5-7-14)16(20)18(9-2-1-3-10-19)15-8-11-23(21,22)12-15/h4-7,15,19H,1-3,8-12H2 |
| InChIKey | NDNKQASVRZYIFZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|