C13H15ClINO4S — CID 103221703
3-chloro-N-(1,1-dioxothiolan-3-yl)-N-(2-hydroxyethyl)-4-iodobenzamide (PubChem CID 103221703) has the molecular formula C13H15ClINO4S and a molecular weight of 443.69 g/mol. Its IUPAC name is 3-chloro-N-(1,1-dioxothiolan-3-yl)-N-(2-hydroxyethyl)-4-iodobenzamide.
| Compound Name | 3-chloro-N-(1,1-dioxothiolan-3-yl)-N-(2-hydroxyethyl)-4-iodobenzamide |
|---|---|
| PubChem CID | 103221703 |
| Molecular Formula | C13H15ClINO4S |
| Molecular Weight | 443.69 g/mol |
| Exact Mass | 442.95 |
| IUPAC Name | 3-chloro-N-(1,1-dioxothiolan-3-yl)-N-(2-hydroxyethyl)-4-iodobenzamide |
| SMILES | O=C(c1ccc(I)c(Cl)c1)N(CCO)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H15ClINO4S/c14-11-7-9(1-2-12(11)15)13(18)16(4-5-17)10-3-6-21(19,20)8-10/h1-2,7,10,17H,3-6,8H2 |
| InChIKey | LVKSBMWAHJIMHT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.69 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|