C13H16ClNO4S — CID 99976451
2-chloro-N-[(3R)-1,1-dioxothiolan-3-yl]-N-[2-(hydroxymethyl)phenyl]acetamide (PubChem CID 99976451) has the molecular formula C13H16ClNO4S and a molecular weight of 317.79 g/mol. Its IUPAC name is 2-chloro-N-[(3R)-1,1-dioxothiolan-3-yl]-N-[2-(hydroxymethyl)phenyl]acetamide.
| Compound Name | 2-chloro-N-[(3R)-1,1-dioxothiolan-3-yl]-N-[2-(hydroxymethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 99976451 |
| Molecular Formula | C13H16ClNO4S |
| Molecular Weight | 317.79 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 2-chloro-N-[(3R)-1,1-dioxothiolan-3-yl]-N-[2-(hydroxymethyl)phenyl]acetamide |
| SMILES | O=C(CCl)N(c1ccccc1CO)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16ClNO4S/c14-7-13(17)15(11-5-6-20(18,19)9-11)12-4-2-1-3-10(12)8-16/h1-4,11,16H,5-9H2/t11-/m1/s1 |
| InChIKey | UPLAUBCBSYFQDB-LLVKDONJSA-N |
| XLogP | 0.94 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.79 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|