C14H18ClNO5S — CID 46398649
2-chloro-N-(3,4-dimethoxyphenyl)-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 46398649) has the molecular formula C14H18ClNO5S and a molecular weight of 347.82 g/mol. Its IUPAC name is 2-chloro-N-(3,4-dimethoxyphenyl)-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-chloro-N-(3,4-dimethoxyphenyl)-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 46398649 |
| Molecular Formula | C14H18ClNO5S |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 2-chloro-N-(3,4-dimethoxyphenyl)-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | COc1ccc(N(C(=O)CCl)C2CCS(=O)(=O)C2)cc1OC |
| InChI | InChI=1S/C14H18ClNO5S/c1-20-12-4-3-10(7-13(12)21-2)16(14(17)8-15)11-5-6-22(18,19)9-11/h3-4,7,11H,5-6,8-9H2,1-2H3 |
| InChIKey | JPFDUTZGNNWWQC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|