C12H15ClN2O3S — CID 99976316
2-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]-N-(6-methyl-2-pyridinyl)acetamide (PubChem CID 99976316) has the molecular formula C12H15ClN2O3S and a molecular weight of 302.78 g/mol. Its IUPAC name is 2-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]-N-(6-methyl-2-pyridinyl)acetamide.
| Compound Name | 2-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]-N-(6-methyl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 99976316 |
| Molecular Formula | C12H15ClN2O3S |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]-N-(6-methyl-2-pyridinyl)acetamide |
| SMILES | Cc1cccc(N(C(=O)CCl)[C@H]2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C12H15ClN2O3S/c1-9-3-2-4-11(14-9)15(12(16)7-13)10-5-6-19(17,18)8-10/h2-4,10H,5-8H2,1H3/t10-/m0/s1 |
| InChIKey | YDQIRUUVJADHLM-JTQLQIEISA-N |
| XLogP | 1.15 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|