C12H11Cl4NO3S — CID 21179828
2,2,2-trichloro-N-(2-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 21179828) has the molecular formula C12H11Cl4NO3S and a molecular weight of 391.10 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(2-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2,2,2-trichloro-N-(2-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 21179828 |
| Molecular Formula | C12H11Cl4NO3S |
| Molecular Weight | 391.10 g/mol |
| Exact Mass | 388.92 |
| IUPAC Name | 2,2,2-trichloro-N-(2-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | O=C(N(c1ccccc1Cl)C1CCS(=O)(=O)C1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H11Cl4NO3S/c13-9-3-1-2-4-10(9)17(11(18)12(14,15)16)8-5-6-21(19,20)7-8/h1-4,8H,5-7H2 |
| InChIKey | IMBZCRNCKYGCOC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.10 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|