C12H10Cl5NO3S — CID 21179831
2,2,2-trichloro-N-(2,3-dichlorophenyl)-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 21179831) has the molecular formula C12H10Cl5NO3S and a molecular weight of 425.55 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(2,3-dichlorophenyl)-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2,2,2-trichloro-N-(2,3-dichlorophenyl)-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 21179831 |
| Molecular Formula | C12H10Cl5NO3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 422.88 |
| IUPAC Name | 2,2,2-trichloro-N-(2,3-dichlorophenyl)-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | O=C(N(c1cccc(Cl)c1Cl)C1CCS(=O)(=O)C1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H10Cl5NO3S/c13-8-2-1-3-9(10(8)14)18(11(19)12(15,16)17)7-4-5-22(20,21)6-7/h1-3,7H,4-6H2 |
| InChIKey | AIAZQUZTQSFROW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|