C11H12N4O4S — CID 62673900
2-[(3-cyanopyrazin-2-yl)-(1,1-dioxothiolan-3-yl)amino]acetic acid (PubChem CID 62673900) has the molecular formula C11H12N4O4S and a molecular weight of 296.31 g/mol. Its IUPAC name is 2-[(3-cyanopyrazin-2-yl)-(1,1-dioxothiolan-3-yl)amino]acetic acid.
| Compound Name | 2-[(3-cyanopyrazin-2-yl)-(1,1-dioxothiolan-3-yl)amino]acetic acid |
|---|---|
| PubChem CID | 62673900 |
| Molecular Formula | C11H12N4O4S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 2-[(3-cyanopyrazin-2-yl)-(1,1-dioxothiolan-3-yl)amino]acetic acid |
| SMILES | N#Cc1nccnc1N(CC(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H12N4O4S/c12-5-9-11(14-3-2-13-9)15(6-10(16)17)8-1-4-20(18,19)7-8/h2-3,8H,1,4,6-7H2,(H,16,17) |
| InChIKey | RVHXAGGKALAZPO-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 124.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |