C14H16N2O4S — CID 60838541
2-[(2-cyanophenyl)methyl-(1,1-dioxothiolan-3-yl)amino]acetic acid (PubChem CID 60838541) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is 2-[(2-cyanophenyl)methyl-(1,1-dioxothiolan-3-yl)amino]acetic acid.
| Compound Name | 2-[(2-cyanophenyl)methyl-(1,1-dioxothiolan-3-yl)amino]acetic acid |
|---|---|
| PubChem CID | 60838541 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-[(2-cyanophenyl)methyl-(1,1-dioxothiolan-3-yl)amino]acetic acid |
| SMILES | N#Cc1ccccc1CN(CC(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H16N2O4S/c15-7-11-3-1-2-4-12(11)8-16(9-14(17)18)13-5-6-21(19,20)10-13/h1-4,13H,5-6,8-10H2,(H,17,18) |
| InChIKey | ILNGKCLRJILTBK-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |