C12H17N3O4S — CID 65059154
2-[(1,1-dioxothiolan-3-yl)-(1-pyrazin-2-ylethyl)amino]acetic acid (PubChem CID 65059154) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-(1-pyrazin-2-ylethyl)amino]acetic acid.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-(1-pyrazin-2-ylethyl)amino]acetic acid |
|---|---|
| PubChem CID | 65059154 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-(1-pyrazin-2-ylethyl)amino]acetic acid |
| SMILES | CC(c1cnccn1)N(CC(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H17N3O4S/c1-9(11-6-13-3-4-14-11)15(7-12(16)17)10-2-5-20(18,19)8-10/h3-4,6,9-10H,2,5,7-8H2,1H3,(H,16,17) |
| InChIKey | AQTUHWVPUJTBOS-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |