C12H13ClN2O2S — CID 55078523
5-chloro-2-[(1,1-dioxothiolan-3-yl)-methylamino]benzonitrile (PubChem CID 55078523) has the molecular formula C12H13ClN2O2S and a molecular weight of 284.77 g/mol. Its IUPAC name is 5-chloro-2-[(1,1-dioxothiolan-3-yl)-methylamino]benzonitrile.
| Compound Name | 5-chloro-2-[(1,1-dioxothiolan-3-yl)-methylamino]benzonitrile |
|---|---|
| PubChem CID | 55078523 |
| Molecular Formula | C12H13ClN2O2S |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 5-chloro-2-[(1,1-dioxothiolan-3-yl)-methylamino]benzonitrile |
| SMILES | CN(c1ccc(Cl)cc1C#N)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H13ClN2O2S/c1-15(11-4-5-18(16,17)8-11)12-3-2-10(13)6-9(12)7-14/h2-3,6,11H,4-5,8H2,1H3 |
| InChIKey | RXBNHWAMUQUAOE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |